C16H21N3O2 — CID 83948774
methyl 5-(2-aminoethyl)-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-6-carboxylate (PubChem CID 83948774) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is methyl 5-(2-aminoethyl)-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-6-carboxylate.
| Compound Name | methyl 5-(2-aminoethyl)-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-6-carboxylate |
|---|---|
| PubChem CID | 83948774 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | methyl 5-(2-aminoethyl)-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-6-carboxylate |
| SMILES | COC(=O)c1cccc2c3c(n(CCN)c12)CCN(C)C3 |
| InChI | InChI=1S/C16H21N3O2/c1-18-8-6-14-13(10-18)11-4-3-5-12(16(20)21-2)15(11)19(14)9-7-17/h3-5H,6-10,17H2,1-2H3 |
| InChIKey | LHHLEEFWGWNCDY-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 60.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|