C14H14ClFN2OS — CID 83952905
5-[(2-chloro-6-fluorophenyl)methyl]-6-propyl-2-sulfanylidene-1H-pyrimidin-4-one (PubChem CID 83952905) has the molecular formula C14H14ClFN2OS and a molecular weight of 312.80 g/mol. Its IUPAC name is 5-[(2-chloro-6-fluorophenyl)methyl]-6-propyl-2-sulfanylidene-1H-pyrimidin-4-one.
| Compound Name | 5-[(2-chloro-6-fluorophenyl)methyl]-6-propyl-2-sulfanylidene-1H-pyrimidin-4-one |
|---|---|
| PubChem CID | 83952905 |
| Molecular Formula | C14H14ClFN2OS |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 5-[(2-chloro-6-fluorophenyl)methyl]-6-propyl-2-sulfanylidene-1H-pyrimidin-4-one |
| SMILES | CCCc1[nH]c(=S)[nH]c(=O)c1Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C14H14ClFN2OS/c1-2-4-12-9(13(19)18-14(20)17-12)7-8-10(15)5-3-6-11(8)16/h3,5-6H,2,4,7H2,1H3,(H2,17,18,19,20) |
| InChIKey | MHGONLCYJZDFJX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|