C18H20Cl2N2OS — CID 163617363
5-[(2,6-dichlorophenyl)methyl]-6-(4-methylcyclohexyl)-2-sulfanylidene-1H-pyrimidin-4-one (PubChem CID 163617363) has the molecular formula C18H20Cl2N2OS and a molecular weight of 383.34 g/mol. Its IUPAC name is 5-[(2,6-dichlorophenyl)methyl]-6-(4-methylcyclohexyl)-2-sulfanylidene-1H-pyrimidin-4-one.
| Compound Name | 5-[(2,6-dichlorophenyl)methyl]-6-(4-methylcyclohexyl)-2-sulfanylidene-1H-pyrimidin-4-one |
|---|---|
| PubChem CID | 163617363 |
| Molecular Formula | C18H20Cl2N2OS |
| Molecular Weight | 383.34 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 5-[(2,6-dichlorophenyl)methyl]-6-(4-methylcyclohexyl)-2-sulfanylidene-1H-pyrimidin-4-one |
| SMILES | CC1CCC(c2[nH]c(=S)[nH]c(=O)c2Cc2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C18H20Cl2N2OS/c1-10-5-7-11(8-6-10)16-13(17(23)22-18(24)21-16)9-12-14(19)3-2-4-15(12)20/h2-4,10-11H,5-9H2,1H3,(H2,21,22,23,24) |
| InChIKey | HLCYSBHVYIEGNL-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.34 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|