C16H12Cl2O4 — CID 83954012
2-[2-carboxy-2-(3,4-dichlorophenyl)ethyl]benzoic acid (PubChem CID 83954012) has the molecular formula C16H12Cl2O4 and a molecular weight of 339.17 g/mol. Its IUPAC name is 2-[2-carboxy-2-(3,4-dichlorophenyl)ethyl]benzoic acid.
| Compound Name | 2-[2-carboxy-2-(3,4-dichlorophenyl)ethyl]benzoic acid |
|---|---|
| PubChem CID | 83954012 |
| Molecular Formula | C16H12Cl2O4 |
| Molecular Weight | 339.17 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 2-[2-carboxy-2-(3,4-dichlorophenyl)ethyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1CC(C(=O)O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H12Cl2O4/c17-13-6-5-10(8-14(13)18)12(16(21)22)7-9-3-1-2-4-11(9)15(19)20/h1-6,8,12H,7H2,(H,19,20)(H,21,22) |
| InChIKey | GNCKIFXRILTMCU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.17 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |