C13H12Cl2N2OS — CID 83954718
5-[(2,4-dichlorophenyl)methyl]-6-ethyl-2-sulfanylidene-1H-pyrimidin-4-one (PubChem CID 83954718) has the molecular formula C13H12Cl2N2OS and a molecular weight of 315.23 g/mol. Its IUPAC name is 5-[(2,4-dichlorophenyl)methyl]-6-ethyl-2-sulfanylidene-1H-pyrimidin-4-one.
| Compound Name | 5-[(2,4-dichlorophenyl)methyl]-6-ethyl-2-sulfanylidene-1H-pyrimidin-4-one |
|---|---|
| PubChem CID | 83954718 |
| Molecular Formula | C13H12Cl2N2OS |
| Molecular Weight | 315.23 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 5-[(2,4-dichlorophenyl)methyl]-6-ethyl-2-sulfanylidene-1H-pyrimidin-4-one |
| SMILES | CCc1[nH]c(=S)[nH]c(=O)c1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H12Cl2N2OS/c1-2-11-9(12(18)17-13(19)16-11)5-7-3-4-8(14)6-10(7)15/h3-4,6H,2,5H2,1H3,(H2,16,17,18,19) |
| InChIKey | FGTZFHNBKVXGIM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.23 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|