C13H13N3O4S — CID 112720693
6-ethyl-5-[(4-hydroxy-3-nitrophenyl)methyl]-2-sulfanylidene-1H-pyrimidin-4-one (PubChem CID 112720693) has the molecular formula C13H13N3O4S and a molecular weight of 307.33 g/mol. Its IUPAC name is 6-ethyl-5-[(4-hydroxy-3-nitrophenyl)methyl]-2-sulfanylidene-1H-pyrimidin-4-one.
| Compound Name | 6-ethyl-5-[(4-hydroxy-3-nitrophenyl)methyl]-2-sulfanylidene-1H-pyrimidin-4-one |
|---|---|
| PubChem CID | 112720693 |
| Molecular Formula | C13H13N3O4S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 6-ethyl-5-[(4-hydroxy-3-nitrophenyl)methyl]-2-sulfanylidene-1H-pyrimidin-4-one |
| SMILES | CCc1[nH]c(=S)[nH]c(=O)c1Cc1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H13N3O4S/c1-2-9-8(12(18)15-13(21)14-9)5-7-3-4-11(17)10(6-7)16(19)20/h3-4,6,17H,2,5H2,1H3,(H2,14,15,18,21) |
| InChIKey | KTJFSJSPZDNBCJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 112.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|