C14H15N3O6 — CID 112720994
5-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methyl]-6-methyl-1H-pyrimidine-2,4-dione (PubChem CID 112720994) has the molecular formula C14H15N3O6 and a molecular weight of 321.29 g/mol. Its IUPAC name is 5-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methyl]-6-methyl-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methyl]-6-methyl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 112720994 |
| Molecular Formula | C14H15N3O6 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 5-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methyl]-6-methyl-1H-pyrimidine-2,4-dione |
| SMILES | CCOc1cc(Cc2c(C)[nH]c(=O)[nH]c2=O)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C14H15N3O6/c1-3-23-11-6-8(5-10(12(11)18)17(21)22)4-9-7(2)15-14(20)16-13(9)19/h5-6,18H,3-4H2,1-2H3,(H2,15,16,19,20) |
| InChIKey | OEAYKYUCBKLWPX-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 138.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|