C10H11F3N2O3 — CID 142924077
2-nitro-4-[(2S)-3,3,3-trifluoro-2-(methylamino)propyl]phenol (PubChem CID 142924077) has the molecular formula C10H11F3N2O3 and a molecular weight of 264.20 g/mol. Its IUPAC name is 2-nitro-4-[(2S)-3,3,3-trifluoro-2-(methylamino)propyl]phenol.
| Compound Name | 2-nitro-4-[(2S)-3,3,3-trifluoro-2-(methylamino)propyl]phenol |
|---|---|
| PubChem CID | 142924077 |
| Molecular Formula | C10H11F3N2O3 |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 2-nitro-4-[(2S)-3,3,3-trifluoro-2-(methylamino)propyl]phenol |
| SMILES | CN[C@@H](Cc1ccc(O)c([N+](=O)[O-])c1)C(F)(F)F |
| InChI | InChI=1S/C10H11F3N2O3/c1-14-9(10(11,12)13)5-6-2-3-8(16)7(4-6)15(17)18/h2-4,9,14,16H,5H2,1H3/t9-/m0/s1 |
| InChIKey | IYBQXAMWMWQSHG-VIFPVBQESA-N |
| XLogP | 1.99 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|