C16H15NO4 — CID 83956223
(Z)-2-(2,5-dimethoxyphenyl)-3-pyridin-3-ylprop-2-enoic acid (PubChem CID 83956223) has the molecular formula C16H15NO4 and a molecular weight of 285.30 g/mol. Its IUPAC name is (Z)-2-(2,5-dimethoxyphenyl)-3-pyridin-3-ylprop-2-enoic acid.
| Compound Name | (Z)-2-(2,5-dimethoxyphenyl)-3-pyridin-3-ylprop-2-enoic acid |
|---|---|
| PubChem CID | 83956223 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | (Z)-2-(2,5-dimethoxyphenyl)-3-pyridin-3-ylprop-2-enoic acid |
| SMILES | COc1ccc(OC)c(/C(=C/c2cccnc2)C(=O)O)c1 |
| InChI | InChI=1S/C16H15NO4/c1-20-12-5-6-15(21-2)13(9-12)14(16(18)19)8-11-4-3-7-17-10-11/h3-10H,1-2H3,(H,18,19)/b14-8- |
| InChIKey | GUGAGHTVIWNPAY-ZSOIEALJSA-N |
| XLogP | 2.72 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|