C16H24N2O3 — CID 83956778
methyl 6-[(3-hydroxypropylamino)methyl]-3-methyl-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 83956778) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is methyl 6-[(3-hydroxypropylamino)methyl]-3-methyl-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | methyl 6-[(3-hydroxypropylamino)methyl]-3-methyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 83956778 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | methyl 6-[(3-hydroxypropylamino)methyl]-3-methyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | COC(=O)N1Cc2ccc(CNCCCO)cc2CC1C |
| InChI | InChI=1S/C16H24N2O3/c1-12-8-15-9-13(10-17-6-3-7-19)4-5-14(15)11-18(12)16(20)21-2/h4-5,9,12,17,19H,3,6-8,10-11H2,1-2H3 |
| InChIKey | UGQHPWNHAMYGGG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|