C14H14F4N2OS — CID 83959728
3-[[4-(4-fluorophenyl)-2-(trifluoromethyl)-1,3-thiazol-5-yl]methylamino]propan-1-ol (PubChem CID 83959728) has the molecular formula C14H14F4N2OS and a molecular weight of 334.34 g/mol. Its IUPAC name is 3-[[4-(4-fluorophenyl)-2-(trifluoromethyl)-1,3-thiazol-5-yl]methylamino]propan-1-ol.
| Compound Name | 3-[[4-(4-fluorophenyl)-2-(trifluoromethyl)-1,3-thiazol-5-yl]methylamino]propan-1-ol |
|---|---|
| PubChem CID | 83959728 |
| Molecular Formula | C14H14F4N2OS |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 3-[[4-(4-fluorophenyl)-2-(trifluoromethyl)-1,3-thiazol-5-yl]methylamino]propan-1-ol |
| SMILES | OCCCNCc1sc(C(F)(F)F)nc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C14H14F4N2OS/c15-10-4-2-9(3-5-10)12-11(8-19-6-1-7-21)22-13(20-12)14(16,17)18/h2-5,19,21H,1,6-8H2 |
| InChIKey | LKUQBNGVJMLGAX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|