C15H22N4O — CID 107848714
6-[(5-phenyl-2H-triazol-4-yl)methylamino]hexan-1-ol (PubChem CID 107848714) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is 6-[(5-phenyl-2H-triazol-4-yl)methylamino]hexan-1-ol.
| Compound Name | 6-[(5-phenyl-2H-triazol-4-yl)methylamino]hexan-1-ol |
|---|---|
| PubChem CID | 107848714 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 6-[(5-phenyl-2H-triazol-4-yl)methylamino]hexan-1-ol |
| SMILES | OCCCCCCNCc1n[nH]nc1-c1ccccc1 |
| InChI | InChI=1S/C15H22N4O/c20-11-7-2-1-6-10-16-12-14-15(18-19-17-14)13-8-4-3-5-9-13/h3-5,8-9,16,20H,1-2,6-7,10-12H2,(H,17,18,19) |
| InChIKey | HKFJDYBTPFJMPU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|