C17H26N4 — CID 63642785
2-ethyl-N-[(5-phenyl-2H-triazol-4-yl)methyl]hexan-1-amine (PubChem CID 63642785) has the molecular formula C17H26N4 and a molecular weight of 286.42 g/mol. Its IUPAC name is 2-ethyl-N-[(5-phenyl-2H-triazol-4-yl)methyl]hexan-1-amine.
| Compound Name | 2-ethyl-N-[(5-phenyl-2H-triazol-4-yl)methyl]hexan-1-amine |
|---|---|
| PubChem CID | 63642785 |
| Molecular Formula | C17H26N4 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | 2-ethyl-N-[(5-phenyl-2H-triazol-4-yl)methyl]hexan-1-amine |
| SMILES | CCCCC(CC)CNCc1n[nH]nc1-c1ccccc1 |
| InChI | InChI=1S/C17H26N4/c1-3-5-9-14(4-2)12-18-13-16-17(20-21-19-16)15-10-7-6-8-11-15/h6-8,10-11,14,18H,3-5,9,12-13H2,1-2H3,(H,19,20,21) |
| InChIKey | MXPIBQRSPVBNSR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |