C15H20N2O2 — CID 83964390
3-(2-aminoethyl)-1-ethyl-2,5-dimethylindole-7-carboxylic acid (PubChem CID 83964390) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 3-(2-aminoethyl)-1-ethyl-2,5-dimethylindole-7-carboxylic acid.
| Compound Name | 3-(2-aminoethyl)-1-ethyl-2,5-dimethylindole-7-carboxylic acid |
|---|---|
| PubChem CID | 83964390 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 3-(2-aminoethyl)-1-ethyl-2,5-dimethylindole-7-carboxylic acid |
| SMILES | CCn1c(C)c(CCN)c2cc(C)cc(C(=O)O)c21 |
| InChI | InChI=1S/C15H20N2O2/c1-4-17-10(3)11(5-6-16)12-7-9(2)8-13(14(12)17)15(18)19/h7-8H,4-6,16H2,1-3H3,(H,18,19) |
| InChIKey | TXUJMPYUYDIWSU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|