C11H17FN4 — CID 83964847
8-fluoro-2-piperidin-4-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 83964847) has the molecular formula C11H17FN4 and a molecular weight of 224.28 g/mol. Its IUPAC name is 8-fluoro-2-piperidin-4-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 8-fluoro-2-piperidin-4-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 83964847 |
| Molecular Formula | C11H17FN4 |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 8-fluoro-2-piperidin-4-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | FC1CCCn2nc(C3CCNCC3)nc21 |
| InChI | InChI=1S/C11H17FN4/c12-9-2-1-7-16-11(9)14-10(15-16)8-3-5-13-6-4-8/h8-9,13H,1-7H2 |
| InChIKey | XXNPDSQVOIVJOI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |