C13H15FN4 — CID 83966866
[4-(8-fluoro-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)phenyl]methanamine (PubChem CID 83966866) has the molecular formula C13H15FN4 and a molecular weight of 246.29 g/mol. Its IUPAC name is [4-(8-fluoro-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)phenyl]methanamine.
| Compound Name | [4-(8-fluoro-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 83966866 |
| Molecular Formula | C13H15FN4 |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | [4-(8-fluoro-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)phenyl]methanamine |
| SMILES | NCc1ccc(-c2nc3n(n2)CCCC3F)cc1 |
| InChI | InChI=1S/C13H15FN4/c14-11-2-1-7-18-13(11)16-12(17-18)10-5-3-9(8-15)4-6-10/h3-6,11H,1-2,7-8,15H2 |
| InChIKey | JKCPHJSROQEQGW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |