C13H13F3N4 — CID 83966868
3-[8-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]aniline (PubChem CID 83966868) has the molecular formula C13H13F3N4 and a molecular weight of 282.27 g/mol. Its IUPAC name is 3-[8-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]aniline.
| Compound Name | 3-[8-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]aniline |
|---|---|
| PubChem CID | 83966868 |
| Molecular Formula | C13H13F3N4 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 3-[8-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]aniline |
| SMILES | Nc1cccc(-c2nc3n(n2)CCCC3C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13F3N4/c14-13(15,16)10-5-2-6-20-12(10)18-11(19-20)8-3-1-4-9(17)7-8/h1,3-4,7,10H,2,5-6,17H2 |
| InChIKey | OAQISRZOFZAPKW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|