C10H9F3N4 — CID 157017173
3-[1-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]aniline (PubChem CID 157017173) has the molecular formula C10H9F3N4 and a molecular weight of 242.20 g/mol. Its IUPAC name is 3-[1-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]aniline.
| Compound Name | 3-[1-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]aniline |
|---|---|
| PubChem CID | 157017173 |
| Molecular Formula | C10H9F3N4 |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 3-[1-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]aniline |
| SMILES | Cn1nc(-c2cccc(N)c2)nc1C(F)(F)F |
| InChI | InChI=1S/C10H9F3N4/c1-17-9(10(11,12)13)15-8(16-17)6-3-2-4-7(14)5-6/h2-5H,14H2,1H3 |
| InChIKey | AOCAOCHBVVRLPO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|