C12H18FN3 — CID 83966721
2-fluoro-8-methyl-1,2,3,4,6,7,8,9-octahydropyrido[1,2-a]benzimidazol-4-amine (PubChem CID 83966721) has the molecular formula C12H18FN3 and a molecular weight of 223.29 g/mol. Its IUPAC name is 2-fluoro-8-methyl-1,2,3,4,6,7,8,9-octahydropyrido[1,2-a]benzimidazol-4-amine.
| Compound Name | 2-fluoro-8-methyl-1,2,3,4,6,7,8,9-octahydropyrido[1,2-a]benzimidazol-4-amine |
|---|---|
| PubChem CID | 83966721 |
| Molecular Formula | C12H18FN3 |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.15 |
| IUPAC Name | 2-fluoro-8-methyl-1,2,3,4,6,7,8,9-octahydropyrido[1,2-a]benzimidazol-4-amine |
| SMILES | CC1CCc2nc3n(c2C1)CC(F)CC3N |
| InChI | InChI=1S/C12H18FN3/c1-7-2-3-10-11(4-7)16-6-8(13)5-9(14)12(16)15-10/h7-9H,2-6,14H2,1H3 |
| InChIKey | QZLMJUUIZHQDHJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |