C9H16N4O — CID 83967046
(8-ethoxy-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)methanamine (PubChem CID 83967046) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is (8-ethoxy-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)methanamine.
| Compound Name | (8-ethoxy-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)methanamine |
|---|---|
| PubChem CID | 83967046 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | (8-ethoxy-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)methanamine |
| SMILES | CCOC1CCCn2nc(CN)nc21 |
| InChI | InChI=1S/C9H16N4O/c1-2-14-7-4-3-5-13-9(7)11-8(6-10)12-13/h7H,2-6,10H2,1H3 |
| InChIKey | IAKLHTBUVWLIST-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |