C10H18N4O — CID 83966839
3-(8-methoxy-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)propan-1-amine (PubChem CID 83966839) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is 3-(8-methoxy-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)propan-1-amine.
| Compound Name | 3-(8-methoxy-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 83966839 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 3-(8-methoxy-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)propan-1-amine |
| SMILES | COC1CCCn2nc(CCCN)nc21 |
| InChI | InChI=1S/C10H18N4O/c1-15-8-4-3-7-14-10(8)12-9(13-14)5-2-6-11/h8H,2-7,11H2,1H3 |
| InChIKey | YLJNUPRRGCRHPE-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |