C18H28N4O — CID 97233340
(8S)-N-(2-adamantyl)-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine (PubChem CID 97233340) has the molecular formula C18H28N4O and a molecular weight of 316.45 g/mol. Its IUPAC name is (8S)-N-(2-adamantyl)-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine.
| Compound Name | (8S)-N-(2-adamantyl)-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
|---|---|
| PubChem CID | 97233340 |
| Molecular Formula | C18H28N4O |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | (8S)-N-(2-adamantyl)-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
| SMILES | COCc1nc2n(n1)CCC[C@@H]2NC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C18H28N4O/c1-23-10-16-20-18-15(3-2-4-22(18)21-16)19-17-13-6-11-5-12(8-13)9-14(17)7-11/h11-15,17,19H,2-10H2,1H3/t11?,12?,13?,14?,15-,17?/m0/s1 |
| InChIKey | GISCRZLNTFJMCT-RWUOKQAASA-N |
| XLogP | 2.67 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |