C14H20N6O3 — CID 138034752
3-ethoxy-N-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-1H-pyrazole-5-carboxamide (PubChem CID 138034752) has the molecular formula C14H20N6O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is 3-ethoxy-N-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-ethoxy-N-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 138034752 |
| Molecular Formula | C14H20N6O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 3-ethoxy-N-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-1H-pyrazole-5-carboxamide |
| SMILES | CCOc1cc(C(=O)NC2CCCn3nc(COC)nc32)[nH]n1 |
| InChI | InChI=1S/C14H20N6O3/c1-3-23-12-7-10(17-18-12)14(21)15-9-5-4-6-20-13(9)16-11(19-20)8-22-2/h7,9H,3-6,8H2,1-2H3,(H,15,21)(H,17,18) |
| InChIKey | BZZUMPMDIOTTHW-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |