C18H21N7O2 — CID 126789083
N-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-2-methyl-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 126789083) has the molecular formula C18H21N7O2 and a molecular weight of 367.41 g/mol. Its IUPAC name is N-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-2-methyl-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-2-methyl-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 126789083 |
| Molecular Formula | C18H21N7O2 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | N-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-2-methyl-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | COCc1nc2n(n1)CCCC2NC(=O)c1ccc(-n2cncn2)cc1C |
| InChI | InChI=1S/C18H21N7O2/c1-12-8-13(25-11-19-10-20-25)5-6-14(12)18(26)21-15-4-3-7-24-17(15)22-16(23-24)9-27-2/h5-6,8,10-11,15H,3-4,7,9H2,1-2H3,(H,21,26) |
| InChIKey | ZHFBVXWVSOBPPR-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 99.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |