C12H23N5O3S — CID 128968425
2-(methoxymethyl)-8-[[methyl(propan-2-yl)sulfamoyl]amino]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 128968425) has the molecular formula C12H23N5O3S and a molecular weight of 317.42 g/mol. Its IUPAC name is 2-(methoxymethyl)-8-[[methyl(propan-2-yl)sulfamoyl]amino]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2-(methoxymethyl)-8-[[methyl(propan-2-yl)sulfamoyl]amino]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 128968425 |
| Molecular Formula | C12H23N5O3S |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 2-(methoxymethyl)-8-[[methyl(propan-2-yl)sulfamoyl]amino]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | COCc1nc2n(n1)CCCC2NS(=O)(=O)N(C)C(C)C |
| InChI | InChI=1S/C12H23N5O3S/c1-9(2)16(3)21(18,19)15-10-6-5-7-17-12(10)13-11(14-17)8-20-4/h9-10,15H,5-8H2,1-4H3 |
| InChIKey | DDNSWEQPNBMICZ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |