C15H18N4O5S — CID 129471482
N-[(8R)-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-1,3-benzodioxole-5-sulfonamide (PubChem CID 129471482) has the molecular formula C15H18N4O5S and a molecular weight of 366.40 g/mol. Its IUPAC name is N-[(8R)-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-1,3-benzodioxole-5-sulfonamide.
| Compound Name | N-[(8R)-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-1,3-benzodioxole-5-sulfonamide |
|---|---|
| PubChem CID | 129471482 |
| Molecular Formula | C15H18N4O5S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | N-[(8R)-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-1,3-benzodioxole-5-sulfonamide |
| SMILES | COCc1nc2n(n1)CCC[C@H]2NS(=O)(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H18N4O5S/c1-22-8-14-16-15-11(3-2-6-19(15)17-14)18-25(20,21)10-4-5-12-13(7-10)24-9-23-12/h4-5,7,11,18H,2-3,6,8-9H2,1H3/t11-/m1/s1 |
| InChIKey | ARYSRRLJZXPIKG-LLVKDONJSA-N |
| XLogP | 0.97 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |