C13H16N6O3 — CID 133364845
2-(methoxymethyl)-N-(3-nitro-2-pyridinyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine (PubChem CID 133364845) has the molecular formula C13H16N6O3 and a molecular weight of 304.31 g/mol. Its IUPAC name is 2-(methoxymethyl)-N-(3-nitro-2-pyridinyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine.
| Compound Name | 2-(methoxymethyl)-N-(3-nitro-2-pyridinyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
|---|---|
| PubChem CID | 133364845 |
| Molecular Formula | C13H16N6O3 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 2-(methoxymethyl)-N-(3-nitro-2-pyridinyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
| SMILES | COCc1nc2n(n1)CCCC2Nc1ncccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16N6O3/c1-22-8-11-16-13-9(4-3-7-18(13)17-11)15-12-10(19(20)21)5-2-6-14-12/h2,5-6,9H,3-4,7-8H2,1H3,(H,14,15) |
| InChIKey | JEKBQYAKDSGBPX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|