C14H25N5O4S — CID 129326756
(2R,5S)-N-[(8S)-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-2,5-dimethylmorpholine-4-sulfonamide (PubChem CID 129326756) has the molecular formula C14H25N5O4S and a molecular weight of 359.45 g/mol. Its IUPAC name is (2R,5S)-N-[(8S)-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-2,5-dimethylmorpholine-4-sulfonamide.
| Compound Name | (2R,5S)-N-[(8S)-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-2,5-dimethylmorpholine-4-sulfonamide |
|---|---|
| PubChem CID | 129326756 |
| Molecular Formula | C14H25N5O4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | (2R,5S)-N-[(8S)-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-2,5-dimethylmorpholine-4-sulfonamide |
| SMILES | COCc1nc2n(n1)CCC[C@@H]2NS(=O)(=O)N1C[C@@H](C)OC[C@@H]1C |
| InChI | InChI=1S/C14H25N5O4S/c1-10-8-23-11(2)7-19(10)24(20,21)17-12-5-4-6-18-14(12)15-13(16-18)9-22-3/h10-12,17H,4-9H2,1-3H3/t10-,11+,12-/m0/s1 |
| InChIKey | MWBCQKMUNFISHN-TUAOUCFPSA-N |
| XLogP | 0.20 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |