C14H20N4O3S2 — CID 129381454
N-[(8S)-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-2,5-dimethylthiophene-3-sulfonamide (PubChem CID 129381454) has the molecular formula C14H20N4O3S2 and a molecular weight of 356.47 g/mol. Its IUPAC name is N-[(8S)-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-2,5-dimethylthiophene-3-sulfonamide.
| Compound Name | N-[(8S)-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-2,5-dimethylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 129381454 |
| Molecular Formula | C14H20N4O3S2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | N-[(8S)-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-2,5-dimethylthiophene-3-sulfonamide |
| SMILES | COCc1nc2n(n1)CCC[C@@H]2NS(=O)(=O)c1cc(C)sc1C |
| InChI | InChI=1S/C14H20N4O3S2/c1-9-7-12(10(2)22-9)23(19,20)17-11-5-4-6-18-14(11)15-13(16-18)8-21-3/h7,11,17H,4-6,8H2,1-3H3/t11-/m0/s1 |
| InChIKey | DGRDDEIFWUJRJH-NSHDSACASA-N |
| XLogP | 1.92 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |