C18H19FN6O — CID 133364902
N-[6-(4-fluorophenyl)pyridazin-3-yl]-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine (PubChem CID 133364902) has the molecular formula C18H19FN6O and a molecular weight of 354.39 g/mol. Its IUPAC name is N-[6-(4-fluorophenyl)pyridazin-3-yl]-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine.
| Compound Name | N-[6-(4-fluorophenyl)pyridazin-3-yl]-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
|---|---|
| PubChem CID | 133364902 |
| Molecular Formula | C18H19FN6O |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | N-[6-(4-fluorophenyl)pyridazin-3-yl]-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
| SMILES | COCc1nc2n(n1)CCCC2Nc1ccc(-c2ccc(F)cc2)nn1 |
| InChI | InChI=1S/C18H19FN6O/c1-26-11-17-21-18-15(3-2-10-25(18)24-17)20-16-9-8-14(22-23-16)12-4-6-13(19)7-5-12/h4-9,15H,2-3,10-11H2,1H3,(H,20,23) |
| InChIKey | RHWZEAVSYLKHFP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |