C20H19NO3S — CID 83967623
4-[[3-(2-propan-2-yl-1,3-thiazol-4-yl)phenoxy]methyl]benzoic acid (PubChem CID 83967623) has the molecular formula C20H19NO3S and a molecular weight of 353.44 g/mol. Its IUPAC name is 4-[[3-(2-propan-2-yl-1,3-thiazol-4-yl)phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[3-(2-propan-2-yl-1,3-thiazol-4-yl)phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 83967623 |
| Molecular Formula | C20H19NO3S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 4-[[3-(2-propan-2-yl-1,3-thiazol-4-yl)phenoxy]methyl]benzoic acid |
| SMILES | CC(C)c1nc(-c2cccc(OCc3ccc(C(=O)O)cc3)c2)cs1 |
| InChI | InChI=1S/C20H19NO3S/c1-13(2)19-21-18(12-25-19)16-4-3-5-17(10-16)24-11-14-6-8-15(9-7-14)20(22)23/h3-10,12-13H,11H2,1-2H3,(H,22,23) |
| InChIKey | OMKVTWMHGBECJQ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |