C15H18N4 — CID 83967871
3-[4-(pyridin-4-ylmethyl)anilino]propanimidamide (PubChem CID 83967871) has the molecular formula C15H18N4 and a molecular weight of 254.34 g/mol. Its IUPAC name is 3-[4-(pyridin-4-ylmethyl)anilino]propanimidamide.
| Compound Name | 3-[4-(pyridin-4-ylmethyl)anilino]propanimidamide |
|---|---|
| PubChem CID | 83967871 |
| Molecular Formula | C15H18N4 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 3-[4-(pyridin-4-ylmethyl)anilino]propanimidamide |
| SMILES | [H]/N=C(\N)CCNc1ccc(Cc2ccncc2)cc1 |
| InChI | InChI=1S/C15H18N4/c16-15(17)7-10-19-14-3-1-12(2-4-14)11-13-5-8-18-9-6-13/h1-6,8-9,19H,7,10-11H2,(H3,16,17) |
| InChIKey | WNOBWSPTDAQUML-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|