C15H12N4O3 — CID 83968707
2-(2-anilino-2-oxoethyl)benzotriazole-5-carboxylic acid (PubChem CID 83968707) has the molecular formula C15H12N4O3 and a molecular weight of 296.29 g/mol. Its IUPAC name is 2-(2-anilino-2-oxoethyl)benzotriazole-5-carboxylic acid.
| Compound Name | 2-(2-anilino-2-oxoethyl)benzotriazole-5-carboxylic acid |
|---|---|
| PubChem CID | 83968707 |
| Molecular Formula | C15H12N4O3 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 2-(2-anilino-2-oxoethyl)benzotriazole-5-carboxylic acid |
| SMILES | O=C(Cn1nc2ccc(C(=O)O)cc2n1)Nc1ccccc1 |
| InChI | InChI=1S/C15H12N4O3/c20-14(16-11-4-2-1-3-5-11)9-19-17-12-7-6-10(15(21)22)8-13(12)18-19/h1-8H,9H2,(H,16,20)(H,21,22) |
| InChIKey | LJGVDVGSGGYLHA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |