C17H23NOS — CID 83973382
3-(3-methylthiophen-2-yl)-2-(3-propoxyphenyl)propan-1-amine (PubChem CID 83973382) has the molecular formula C17H23NOS and a molecular weight of 289.44 g/mol. Its IUPAC name is 3-(3-methylthiophen-2-yl)-2-(3-propoxyphenyl)propan-1-amine.
| Compound Name | 3-(3-methylthiophen-2-yl)-2-(3-propoxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 83973382 |
| Molecular Formula | C17H23NOS |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 3-(3-methylthiophen-2-yl)-2-(3-propoxyphenyl)propan-1-amine |
| SMILES | CCCOc1cccc(C(CN)Cc2sccc2C)c1 |
| InChI | InChI=1S/C17H23NOS/c1-3-8-19-16-6-4-5-14(10-16)15(12-18)11-17-13(2)7-9-20-17/h4-7,9-10,15H,3,8,11-12,18H2,1-2H3 |
| InChIKey | DXWQRFDQZRIABZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |