C16H20ClNOS — CID 83973518
2-(3-chloro-4-ethoxyphenyl)-3-(3-methylthiophen-2-yl)propan-1-amine (PubChem CID 83973518) has the molecular formula C16H20ClNOS and a molecular weight of 309.86 g/mol. Its IUPAC name is 2-(3-chloro-4-ethoxyphenyl)-3-(3-methylthiophen-2-yl)propan-1-amine.
| Compound Name | 2-(3-chloro-4-ethoxyphenyl)-3-(3-methylthiophen-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 83973518 |
| Molecular Formula | C16H20ClNOS |
| Molecular Weight | 309.86 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 2-(3-chloro-4-ethoxyphenyl)-3-(3-methylthiophen-2-yl)propan-1-amine |
| SMILES | CCOc1ccc(C(CN)Cc2sccc2C)cc1Cl |
| InChI | InChI=1S/C16H20ClNOS/c1-3-19-15-5-4-12(8-14(15)17)13(10-18)9-16-11(2)6-7-20-16/h4-8,13H,3,9-10,18H2,1-2H3 |
| InChIKey | XPTBSQSPUTWPHN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.86 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |