C22H28N2O — CID 83976433
2-(5-methyl-1H-indol-3-yl)-3-[3-(2-methylpropoxy)phenyl]propan-1-amine (PubChem CID 83976433) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is 2-(5-methyl-1H-indol-3-yl)-3-[3-(2-methylpropoxy)phenyl]propan-1-amine.
| Compound Name | 2-(5-methyl-1H-indol-3-yl)-3-[3-(2-methylpropoxy)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 83976433 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 2-(5-methyl-1H-indol-3-yl)-3-[3-(2-methylpropoxy)phenyl]propan-1-amine |
| SMILES | Cc1ccc2[nH]cc(C(CN)Cc3cccc(OCC(C)C)c3)c2c1 |
| InChI | InChI=1S/C22H28N2O/c1-15(2)14-25-19-6-4-5-17(11-19)10-18(12-23)21-13-24-22-8-7-16(3)9-20(21)22/h4-9,11,13,15,18,24H,10,12,14,23H2,1-3H3 |
| InChIKey | MSUHZIVACCTIRT-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |