C16H22N2OS — CID 83976595
2-(5-methoxy-1H-indol-3-yl)-2-(thian-4-yl)ethanamine (PubChem CID 83976595) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is 2-(5-methoxy-1H-indol-3-yl)-2-(thian-4-yl)ethanamine.
| Compound Name | 2-(5-methoxy-1H-indol-3-yl)-2-(thian-4-yl)ethanamine |
|---|---|
| PubChem CID | 83976595 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2-(5-methoxy-1H-indol-3-yl)-2-(thian-4-yl)ethanamine |
| SMILES | COc1ccc2[nH]cc(C(CN)C3CCSCC3)c2c1 |
| InChI | InChI=1S/C16H22N2OS/c1-19-12-2-3-16-13(8-12)15(10-18-16)14(9-17)11-4-6-20-7-5-11/h2-3,8,10-11,14,18H,4-7,9,17H2,1H3 |
| InChIKey | VBUABTZDCCTPQE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |