C18H32N4 — CID 83977871
4-[2-amino-1-(3-methyl-4-propylpiperazin-1-yl)ethyl]-N,N-dimethylaniline (PubChem CID 83977871) has the molecular formula C18H32N4 and a molecular weight of 304.48 g/mol. Its IUPAC name is 4-[2-amino-1-(3-methyl-4-propylpiperazin-1-yl)ethyl]-N,N-dimethylaniline.
| Compound Name | 4-[2-amino-1-(3-methyl-4-propylpiperazin-1-yl)ethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 83977871 |
| Molecular Formula | C18H32N4 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.26 |
| IUPAC Name | 4-[2-amino-1-(3-methyl-4-propylpiperazin-1-yl)ethyl]-N,N-dimethylaniline |
| SMILES | CCCN1CCN(C(CN)c2ccc(N(C)C)cc2)CC1C |
| InChI | InChI=1S/C18H32N4/c1-5-10-21-11-12-22(14-15(21)2)18(13-19)16-6-8-17(9-7-16)20(3)4/h6-9,15,18H,5,10-14,19H2,1-4H3 |
| InChIKey | BNNZLBIDFZBYFL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 35.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|