C15H25N3O — CID 83977987
3-[2-(dimethylamino)-1-(2-methylpiperazin-1-yl)ethyl]phenol (PubChem CID 83977987) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is 3-[2-(dimethylamino)-1-(2-methylpiperazin-1-yl)ethyl]phenol.
| Compound Name | 3-[2-(dimethylamino)-1-(2-methylpiperazin-1-yl)ethyl]phenol |
|---|---|
| PubChem CID | 83977987 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 3-[2-(dimethylamino)-1-(2-methylpiperazin-1-yl)ethyl]phenol |
| SMILES | CC1CNCCN1C(CN(C)C)c1cccc(O)c1 |
| InChI | InChI=1S/C15H25N3O/c1-12-10-16-7-8-18(12)15(11-17(2)3)13-5-4-6-14(19)9-13/h4-6,9,12,15-16,19H,7-8,10-11H2,1-3H3 |
| InChIKey | ALVFSKGLCOQCJR-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |