C19H18N2O2S — CID 839830
(5Z)-3-methyl-5-[[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 839830) has the molecular formula C19H18N2O2S and a molecular weight of 338.43 g/mol. Its IUPAC name is (5Z)-3-methyl-5-[[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-3-methyl-5-[[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 839830 |
| Molecular Formula | C19H18N2O2S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | (5Z)-3-methyl-5-[[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | Cc1cccc(COc2ccc(/C=C3\NC(=S)N(C)C3=O)cc2)c1 |
| InChI | InChI=1S/C19H18N2O2S/c1-13-4-3-5-15(10-13)12-23-16-8-6-14(7-9-16)11-17-18(22)21(2)19(24)20-17/h3-11H,12H2,1-2H3,(H,20,24)/b17-11- |
| InChIKey | RVAMDMCORQCAOA-BOPFTXTBSA-N |
| XLogP | 3.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|