C14H26N2 — CID 83983513
1-(1-azatricyclo[5.2.2.02,6]undecan-4-yl)butan-2-amine (PubChem CID 83983513) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is 1-(1-azatricyclo[5.2.2.02,6]undecan-4-yl)butan-2-amine.
| Compound Name | 1-(1-azatricyclo[5.2.2.02,6]undecan-4-yl)butan-2-amine |
|---|---|
| PubChem CID | 83983513 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 1-(1-azatricyclo[5.2.2.02,6]undecan-4-yl)butan-2-amine |
| SMILES | CCC(N)CC1CC2C3CCN(CC3)C2C1 |
| InChI | InChI=1S/C14H26N2/c1-2-12(15)7-10-8-13-11-3-5-16(6-4-11)14(13)9-10/h10-14H,2-9,15H2,1H3 |
| InChIKey | UZVJURGZPWLCKV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |