About 1-(6-methyl-1-propyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)pentan-3-amine
1-(6-methyl-1-propyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)pentan-3-amine (PubChem CID 83983784) has the molecular formula C19H29N3
and a molecular weight of 299.46 g/mol. Its IUPAC name is 1-(6-methyl-1-propyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)pentan-3-amine.
Molecular Properties
| Compound Name | 1-(6-methyl-1-propyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)pentan-3-amine |
| PubChem CID | 83983784 |
| Molecular Formula | C19H29N3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | 1-(6-methyl-1-propyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)pentan-3-amine |
| SMILES | CCCn1cc(CCC(N)CC)c2cc3c(cc21)CN(C)C3 |
| InChI | InChI=1S/C19H29N3/c1-4-8-22-13-14(6-7-17(20)5-2)18-9-15-11-21(3)12-16(15)10-19(18)22/h9-10,13,17H,4-8,11-12,20H2,1-3H3 |
| InChIKey | DTHRXVFNWZMAEY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 34.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(6-methyl-1-propyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)pentan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-methyl-1-propyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)pentan-3-amine?
The IUPAC name of 1-(6-methyl-1-propyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)pentan-3-amine (CID 83983784) is 1-(6-methyl-1-propyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)pentan-3-amine.
What is the SMILES notation for 1-(6-methyl-1-propyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)pentan-3-amine?
The canonical SMILES for 1-(6-methyl-1-propyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)pentan-3-amine is CCCn1cc(CCC(N)CC)c2cc3c(cc21)CN(C)C3.
What is the InChIKey of 1-(6-methyl-1-propyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)pentan-3-amine?
The InChIKey is DTHRXVFNWZMAEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29N3/c1-4-8-22-13-14(6-7-17(20)5-2)18-9-15-11-21(3)12-16(15)10-19(18)22/h9-10,13,17H,4-8,11-12,20H2,1-3H3.
What are the key properties of 1-(6-methyl-1-propyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)pentan-3-amine?
1-(6-methyl-1-propyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)pentan-3-amine has a molecular weight of 299.46 g/mol, XLogP of 3.67, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-methyl-1-propyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)pentan-3-amine is sourced from PubChem (CID 83983784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).