C14H18N2O4S — CID 83985062
2-(methylamino)-3-(1-methyl-5-methylsulfonylindol-3-yl)propanoic acid (PubChem CID 83985062) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is 2-(methylamino)-3-(1-methyl-5-methylsulfonylindol-3-yl)propanoic acid.
| Compound Name | 2-(methylamino)-3-(1-methyl-5-methylsulfonylindol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 83985062 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 2-(methylamino)-3-(1-methyl-5-methylsulfonylindol-3-yl)propanoic acid |
| SMILES | CNC(Cc1cn(C)c2ccc(S(C)(=O)=O)cc12)C(=O)O |
| InChI | InChI=1S/C14H18N2O4S/c1-15-12(14(17)18)6-9-8-16(2)13-5-4-10(7-11(9)13)21(3,19)20/h4-5,7-8,12,15H,6H2,1-3H3,(H,17,18) |
| InChIKey | MEKSDNMCTNMBAE-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |