About methyl 2-(4-propyl-1,4-diazatricyclo[5.2.2.02,6]undecan-3-yl)acetate
methyl 2-(4-propyl-1,4-diazatricyclo[5.2.2.02,6]undecan-3-yl)acetate (PubChem CID 83986068) has the molecular formula C15H26N2O2
and a molecular weight of 266.38 g/mol. Its IUPAC name is methyl 2-(4-propyl-1,4-diazatricyclo[5.2.2.02,6]undecan-3-yl)acetate.
Analyze methyl 2-(4-propyl-1,4-diazatricyclo[5.2.2.02,6]undecan-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(4-propyl-1,4-diazatricyclo[5.2.2.02,6]undecan-3-yl)acetate?
The IUPAC name of methyl 2-(4-propyl-1,4-diazatricyclo[5.2.2.02,6]undecan-3-yl)acetate (CID 83986068) is methyl 2-(4-propyl-1,4-diazatricyclo[5.2.2.02,6]undecan-3-yl)acetate.
What is the SMILES notation for methyl 2-(4-propyl-1,4-diazatricyclo[5.2.2.02,6]undecan-3-yl)acetate?
The canonical SMILES for methyl 2-(4-propyl-1,4-diazatricyclo[5.2.2.02,6]undecan-3-yl)acetate is CCCN1CC2C3CCN(CC3)C2C1CC(=O)OC.
What is the InChIKey of methyl 2-(4-propyl-1,4-diazatricyclo[5.2.2.02,6]undecan-3-yl)acetate?
The InChIKey is RLKGZBGXBJCVCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2O2/c1-3-6-17-10-12-11-4-7-16(8-5-11)15(12)13(17)9-14(18)19-2/h11-13,15H,3-10H2,1-2H3.
What are the key properties of methyl 2-(4-propyl-1,4-diazatricyclo[5.2.2.02,6]undecan-3-yl)acetate?
methyl 2-(4-propyl-1,4-diazatricyclo[5.2.2.02,6]undecan-3-yl)acetate has a molecular weight of 266.38 g/mol, XLogP of 1.35, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4-propyl-1,4-diazatricyclo[5.2.2.02,6]undecan-3-yl)acetate is sourced from PubChem (CID 83986068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).