C18H27N3O — CID 83986828
2-(3-tert-butyl-1-methylpyrazol-5-yl)-2-(4-methoxy-3-methylphenyl)ethanamine (PubChem CID 83986828) has the molecular formula C18H27N3O and a molecular weight of 301.43 g/mol. Its IUPAC name is 2-(3-tert-butyl-1-methylpyrazol-5-yl)-2-(4-methoxy-3-methylphenyl)ethanamine.
| Compound Name | 2-(3-tert-butyl-1-methylpyrazol-5-yl)-2-(4-methoxy-3-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 83986828 |
| Molecular Formula | C18H27N3O |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | 2-(3-tert-butyl-1-methylpyrazol-5-yl)-2-(4-methoxy-3-methylphenyl)ethanamine |
| SMILES | COc1ccc(C(CN)c2cc(C(C)(C)C)nn2C)cc1C |
| InChI | InChI=1S/C18H27N3O/c1-12-9-13(7-8-16(12)22-6)14(11-19)15-10-17(18(2,3)4)20-21(15)5/h7-10,14H,11,19H2,1-6H3 |
| InChIKey | LFDJXEBFDOURCD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |