C20H31N3 — CID 83987721
2-(3-tert-butyl-1-methylpyrazol-5-yl)-2-(4-tert-butylphenyl)ethanamine (PubChem CID 83987721) has the molecular formula C20H31N3 and a molecular weight of 313.49 g/mol. Its IUPAC name is 2-(3-tert-butyl-1-methylpyrazol-5-yl)-2-(4-tert-butylphenyl)ethanamine.
| Compound Name | 2-(3-tert-butyl-1-methylpyrazol-5-yl)-2-(4-tert-butylphenyl)ethanamine |
|---|---|
| PubChem CID | 83987721 |
| Molecular Formula | C20H31N3 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.25 |
| IUPAC Name | 2-(3-tert-butyl-1-methylpyrazol-5-yl)-2-(4-tert-butylphenyl)ethanamine |
| SMILES | Cn1nc(C(C)(C)C)cc1C(CN)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H31N3/c1-19(2,3)15-10-8-14(9-11-15)16(13-21)17-12-18(20(4,5)6)22-23(17)7/h8-12,16H,13,21H2,1-7H3 |
| InChIKey | RTWZDVKRDLBZLM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |