C18H17F2N3 — CID 83987350
2-(3-fluorophenyl)-2-[3-(4-fluorophenyl)-1-methylpyrazol-5-yl]ethanamine (PubChem CID 83987350) has the molecular formula C18H17F2N3 and a molecular weight of 313.35 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-2-[3-(4-fluorophenyl)-1-methylpyrazol-5-yl]ethanamine.
| Compound Name | 2-(3-fluorophenyl)-2-[3-(4-fluorophenyl)-1-methylpyrazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 83987350 |
| Molecular Formula | C18H17F2N3 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 2-(3-fluorophenyl)-2-[3-(4-fluorophenyl)-1-methylpyrazol-5-yl]ethanamine |
| SMILES | Cn1nc(-c2ccc(F)cc2)cc1C(CN)c1cccc(F)c1 |
| InChI | InChI=1S/C18H17F2N3/c1-23-18(16(11-21)13-3-2-4-15(20)9-13)10-17(22-23)12-5-7-14(19)8-6-12/h2-10,16H,11,21H2,1H3 |
| InChIKey | KOJHLQWRLLGCCK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |