C18H14F2N2O2 — CID 94813590
6-(4-fluorophenyl)-2-[(2S)-2-(3-fluorophenyl)-2-hydroxyethyl]pyridazin-3-one (PubChem CID 94813590) has the molecular formula C18H14F2N2O2 and a molecular weight of 328.32 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-2-[(2S)-2-(3-fluorophenyl)-2-hydroxyethyl]pyridazin-3-one.
| Compound Name | 6-(4-fluorophenyl)-2-[(2S)-2-(3-fluorophenyl)-2-hydroxyethyl]pyridazin-3-one |
|---|---|
| PubChem CID | 94813590 |
| Molecular Formula | C18H14F2N2O2 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 6-(4-fluorophenyl)-2-[(2S)-2-(3-fluorophenyl)-2-hydroxyethyl]pyridazin-3-one |
| SMILES | O=c1ccc(-c2ccc(F)cc2)nn1C[C@@H](O)c1cccc(F)c1 |
| InChI | InChI=1S/C18H14F2N2O2/c19-14-6-4-12(5-7-14)16-8-9-18(24)22(21-16)11-17(23)13-2-1-3-15(20)10-13/h1-10,17,23H,11H2/t17-/m1/s1 |
| InChIKey | XOKTTXJMEHQAIJ-QGZVFWFLSA-N |
| XLogP | 2.92 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |