C23H25FN2O3 — CID 60612567
2-[3-(4-tert-butylphenoxy)-2-hydroxypropyl]-6-(4-fluorophenyl)pyridazin-3-one (PubChem CID 60612567) has the molecular formula C23H25FN2O3 and a molecular weight of 396.46 g/mol. Its IUPAC name is 2-[3-(4-tert-butylphenoxy)-2-hydroxypropyl]-6-(4-fluorophenyl)pyridazin-3-one.
| Compound Name | 2-[3-(4-tert-butylphenoxy)-2-hydroxypropyl]-6-(4-fluorophenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 60612567 |
| Molecular Formula | C23H25FN2O3 |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 2-[3-(4-tert-butylphenoxy)-2-hydroxypropyl]-6-(4-fluorophenyl)pyridazin-3-one |
| SMILES | CC(C)(C)c1ccc(OCC(O)Cn2nc(-c3ccc(F)cc3)ccc2=O)cc1 |
| InChI | InChI=1S/C23H25FN2O3/c1-23(2,3)17-6-10-20(11-7-17)29-15-19(27)14-26-22(28)13-12-21(25-26)16-4-8-18(24)9-5-16/h4-13,19,27H,14-15H2,1-3H3 |
| InChIKey | HZUGEQBXMUQYFD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |