C14H13F3N2O3 — CID 97242146
2-[(2S)-2-hydroxy-3-phenoxypropyl]-6-(trifluoromethyl)pyridazin-3-one (PubChem CID 97242146) has the molecular formula C14H13F3N2O3 and a molecular weight of 314.26 g/mol. Its IUPAC name is 2-[(2S)-2-hydroxy-3-phenoxypropyl]-6-(trifluoromethyl)pyridazin-3-one.
| Compound Name | 2-[(2S)-2-hydroxy-3-phenoxypropyl]-6-(trifluoromethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 97242146 |
| Molecular Formula | C14H13F3N2O3 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 2-[(2S)-2-hydroxy-3-phenoxypropyl]-6-(trifluoromethyl)pyridazin-3-one |
| SMILES | O=c1ccc(C(F)(F)F)nn1C[C@H](O)COc1ccccc1 |
| InChI | InChI=1S/C14H13F3N2O3/c15-14(16,17)12-6-7-13(21)19(18-12)8-10(20)9-22-11-4-2-1-3-5-11/h1-7,10,20H,8-9H2/t10-/m0/s1 |
| InChIKey | DDCOEQABQGZXBN-JTQLQIEISA-N |
| XLogP | 1.70 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |